DOTA Powder Cas No.60239-18-1

DOTA is a high-performance macrocyclic polyamine carboxylic acid chelating agent produced by Xi'an Tihealth using advanced technology. This product has an extremely strong metal ion chelating ability and can form highly stable complexes with various divalent and trivalent metal ions, making it a key raw material in the fields of nuclear medicine, molecular imaging, and targeted therapy.

Melting Point: 267 °C

Boiling Point: 701.6±60.0 °C (Predicted)

Density: 1.321

Solubility: Water (Slightly, Heated), Methanol (Slightly)

Form: Powder

pKa: 2.16±0.10 (Predicted)

BRN: 1186987

Stability: Hygroscopic

InChI: InChI=1S/C16H28N4O8/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28)

InChIKey: WDLRUFUQRNWCPK-UHFFFAOYSA-N

SMILES: N1(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CCN(CC(O)=O)CC1

High Purity: HPLC purity ≥ 98%, ensuring chelation efficiency and stability.

Strict Quality Control: Multiple tests such as HPLC, NMR, MS ensure high batch consistency.

Stable Supply: Mass production supports customized packaging and specifications.

Wide Application: Compatible with various metal ions (such as Gd³⁺, Cu²⁺, Lu³⁺, etc.), suitable for nuclear medicine, imaging diagnosis, and other fields.

Efficient chelation: The tetracarboxylic acid structure strongly binds metal ions to form stable complexes.

Multifunctional modification: Can activate carboxyl groups (such as NHS esters) for coupling with biomolecules (antibodies, peptides).

Low toxicity: Suitable for in vivo diagnostic and therapeutic applications.

Nuclear Medicine: Used for the labeling of radioactive isotopes such as ⁶⁸Ga and ¹⁷⁷Lu to prepare PET/SPECT imaging agents or targeted therapeutic drugs.

MRI Contrast Agents: Gadolinium (Gd³⁺)-DOTA complexes used as T1-weighted imaging enhancers.

Scientific Research Reagents: Metal ion probes, molecular imaging studies.

Targeted Drug Carriers: Conjugated antibodies/peptides for precise delivery.

Chelation: Four nitrogen atoms and four carboxyl oxygen atoms form an octahedral stable structure with the metal ion, preventing the ion from being free.

Enhanced Imaging: Metal-DOTA complexes (such as Gd-DOTA) change the local magnetic field, increasing MRI signal contrast.

Targeted Therapy: Radioactive metal-DOTA-biomolecules bind specifically to lesions, releasing radiation or drugs.